C13H24N4O — CID 64831318
2-[4-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]pyrazol-1-yl]ethanol (PubChem CID 64831318) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[4-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 64831318 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-[4-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]pyrazol-1-yl]ethanol |
| SMILES | CCN1CCCC1CNCc1cnn(CCO)c1 |
| InChI | InChI=1S/C13H24N4O/c1-2-16-5-3-4-13(16)10-14-8-12-9-15-17(11-12)6-7-18/h9,11,13-14,18H,2-8,10H2,1H3 |
| InChIKey | KZZICRYAJRCHTC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |