C35H33N7O3 — CID 6483216
4-(3-amino-4-methylphenyl)-3-[[4-[1-cyclohexyl-5-(2H-tetrazol-5-yl)benzimidazol-2-yl]phenoxy]methyl]benzoic acid (PubChem CID 6483216) has the molecular formula C35H33N7O3 and a molecular weight of 599.70 g/mol. Its IUPAC name is 4-(3-amino-4-methylphenyl)-3-[[4-[1-cyclohexyl-5-(2H-tetrazol-5-yl)benzimidazol-2-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-(3-amino-4-methylphenyl)-3-[[4-[1-cyclohexyl-5-(2H-tetrazol-5-yl)benzimidazol-2-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 6483216 |
| Molecular Formula | C35H33N7O3 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | 4-(3-amino-4-methylphenyl)-3-[[4-[1-cyclohexyl-5-(2H-tetrazol-5-yl)benzimidazol-2-yl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)cc2COc2ccc(-c3nc4cc(-c5nn[nH]n5)ccc4n3C3CCCCC3)cc2)cc1N |
| InChI | InChI=1S/C35H33N7O3/c1-21-7-8-23(18-30(21)36)29-15-11-25(35(43)44)17-26(29)20-45-28-13-9-22(10-14-28)34-37-31-19-24(33-38-40-41-39-33)12-16-32(31)42(34)27-5-3-2-4-6-27/h7-19,27H,2-6,20,36H2,1H3,(H,43,44)(H,38,39,40,41) |
| InChIKey | VTOCGFGUKMLBFK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|