C11H17N3OS — CID 6483849
3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-ethylpropanamide (PubChem CID 6483849) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-ethylpropanamide.
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-ethylpropanamide |
|---|---|
| PubChem CID | 6483849 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-ethylpropanamide |
| SMILES | CCNC(=O)CCSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C11H17N3OS/c1-4-12-10(15)5-6-16-11-13-8(2)7-9(3)14-11/h7H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | OKVNFAWNIOMUME-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |