C16H27BrN2S — CID 64840856
1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-propylpiperazine (PubChem CID 64840856) has the molecular formula C16H27BrN2S and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-propylpiperazine.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-propylpiperazine |
|---|---|
| PubChem CID | 64840856 |
| Molecular Formula | C16H27BrN2S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-propylpiperazine |
| SMILES | CCCC1CNC(C(C)(C)C)CN1Cc1sccc1Br |
| InChI | InChI=1S/C16H27BrN2S/c1-5-6-12-9-18-15(16(2,3)4)11-19(12)10-14-13(17)7-8-20-14/h7-8,12,15,18H,5-6,9-11H2,1-4H3 |
| InChIKey | IEGSDTDJUDVNPW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |