C17H29BrN2S — CID 64841646
1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-(2-methylpropyl)piperazine (PubChem CID 64841646) has the molecular formula C17H29BrN2S and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-(2-methylpropyl)piperazine.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 64841646 |
| Molecular Formula | C17H29BrN2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-5-tert-butyl-2-(2-methylpropyl)piperazine |
| SMILES | CC(C)CC1CNC(C(C)(C)C)CN1Cc1sccc1Br |
| InChI | InChI=1S/C17H29BrN2S/c1-12(2)8-13-9-19-16(17(3,4)5)11-20(13)10-15-14(18)6-7-21-15/h6-7,12-13,16,19H,8-11H2,1-5H3 |
| InChIKey | OQQADGNGUDIDRB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |