C16H25BrN2S — CID 64848627
1-[(3-bromothiophen-2-yl)methyl]-5-butan-2-yl-2-cyclopropylpiperazine (PubChem CID 64848627) has the molecular formula C16H25BrN2S and a molecular weight of 357.36 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-5-butan-2-yl-2-cyclopropylpiperazine.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-5-butan-2-yl-2-cyclopropylpiperazine |
|---|---|
| PubChem CID | 64848627 |
| Molecular Formula | C16H25BrN2S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-5-butan-2-yl-2-cyclopropylpiperazine |
| SMILES | CCC(C)C1CN(Cc2sccc2Br)C(C2CC2)CN1 |
| InChI | InChI=1S/C16H25BrN2S/c1-3-11(2)14-9-19(10-16-13(17)6-7-20-16)15(8-18-14)12-4-5-12/h6-7,11-12,14-15,18H,3-5,8-10H2,1-2H3 |
| InChIKey | QTKHGXPKAJXDTG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |