C17H29BrN2S — CID 64848042
1-[(3-bromothiophen-2-yl)methyl]-2,5-di(butan-2-yl)piperazine (PubChem CID 64848042) has the molecular formula C17H29BrN2S and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-2,5-di(butan-2-yl)piperazine.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-2,5-di(butan-2-yl)piperazine |
|---|---|
| PubChem CID | 64848042 |
| Molecular Formula | C17H29BrN2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-2,5-di(butan-2-yl)piperazine |
| SMILES | CCC(C)C1CN(Cc2sccc2Br)C(C(C)CC)CN1 |
| InChI | InChI=1S/C17H29BrN2S/c1-5-12(3)15-10-20(11-17-14(18)7-8-21-17)16(9-19-15)13(4)6-2/h7-8,12-13,15-16,19H,5-6,9-11H2,1-4H3 |
| InChIKey | PDAAUVGMKIOITM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |