C17H26BrFN2 — CID 64841431
1-[(3-bromo-4-fluorophenyl)methyl]-5-tert-butyl-2-ethylpiperazine (PubChem CID 64841431) has the molecular formula C17H26BrFN2 and a molecular weight of 357.31 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]-5-tert-butyl-2-ethylpiperazine.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]-5-tert-butyl-2-ethylpiperazine |
|---|---|
| PubChem CID | 64841431 |
| Molecular Formula | C17H26BrFN2 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]-5-tert-butyl-2-ethylpiperazine |
| SMILES | CCC1CNC(C(C)(C)C)CN1Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H26BrFN2/c1-5-13-9-20-16(17(2,3)4)11-21(13)10-12-6-7-15(19)14(18)8-12/h6-8,13,16,20H,5,9-11H2,1-4H3 |
| InChIKey | YFIUGEOWXYCFFL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |