C19H32N2 — CID 64842595
5-tert-butyl-1-[(3,4-dimethylphenyl)methyl]-2-ethylpiperazine (PubChem CID 64842595) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 5-tert-butyl-1-[(3,4-dimethylphenyl)methyl]-2-ethylpiperazine.
| Compound Name | 5-tert-butyl-1-[(3,4-dimethylphenyl)methyl]-2-ethylpiperazine |
|---|---|
| PubChem CID | 64842595 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 5-tert-butyl-1-[(3,4-dimethylphenyl)methyl]-2-ethylpiperazine |
| SMILES | CCC1CNC(C(C)(C)C)CN1Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H32N2/c1-7-17-11-20-18(19(4,5)6)13-21(17)12-16-9-8-14(2)15(3)10-16/h8-10,17-18,20H,7,11-13H2,1-6H3 |
| InChIKey | BVPJQXOYUWDHGT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |