C17H26F2N2 — CID 82802883
5-tert-butyl-1-(2,6-difluoro-3-methylphenyl)-2-ethylpiperazine (PubChem CID 82802883) has the molecular formula C17H26F2N2 and a molecular weight of 296.40 g/mol. Its IUPAC name is 5-tert-butyl-1-(2,6-difluoro-3-methylphenyl)-2-ethylpiperazine.
| Compound Name | 5-tert-butyl-1-(2,6-difluoro-3-methylphenyl)-2-ethylpiperazine |
|---|---|
| PubChem CID | 82802883 |
| Molecular Formula | C17H26F2N2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 5-tert-butyl-1-(2,6-difluoro-3-methylphenyl)-2-ethylpiperazine |
| SMILES | CCC1CNC(C(C)(C)C)CN1c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C17H26F2N2/c1-6-12-9-20-14(17(3,4)5)10-21(12)16-13(18)8-7-11(2)15(16)19/h7-8,12,14,20H,6,9-10H2,1-5H3 |
| InChIKey | RSHFWBVGBNRHBM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |