C15H27F3N2O — CID 64841649
5-tert-butyl-2-cyclopropyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine (PubChem CID 64841649) has the molecular formula C15H27F3N2O and a molecular weight of 308.39 g/mol. Its IUPAC name is 5-tert-butyl-2-cyclopropyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine.
| Compound Name | 5-tert-butyl-2-cyclopropyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 64841649 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 5-tert-butyl-2-cyclopropyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine |
| SMILES | CC(C)(C)C1CN(CCOCC(F)(F)F)C(C2CC2)CN1 |
| InChI | InChI=1S/C15H27F3N2O/c1-14(2,3)13-9-20(6-7-21-10-15(16,17)18)12(8-19-13)11-4-5-11/h11-13,19H,4-10H2,1-3H3 |
| InChIKey | SEMVQEFNTISSIO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|