About 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine
5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine (PubChem CID 64848456) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine.
Molecular Properties
| Compound Name | 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine |
| PubChem CID | 64848456 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine |
| SMILES | CCC(C)C1CN(C2CCOC2)C(CC)(CC)CN1 |
| InChI | InChI=1S/C16H32N2O/c1-5-13(4)15-10-18(14-8-9-19-11-14)16(6-2,7-3)12-17-15/h13-15,17H,5-12H2,1-4H3 |
| InChIKey | WZHRCGKRGOWNQR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine?
The IUPAC name of 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine (CID 64848456) is 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine.
What is the SMILES notation for 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine?
The canonical SMILES for 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine is CCC(C)C1CN(C2CCOC2)C(CC)(CC)CN1.
What is the InChIKey of 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine?
The InChIKey is WZHRCGKRGOWNQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O/c1-5-13(4)15-10-18(14-8-9-19-11-14)16(6-2,7-3)12-17-15/h13-15,17H,5-12H2,1-4H3.
What are the key properties of 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine?
5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine has a molecular weight of 268.44 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2,2-diethyl-1-(oxolan-3-yl)piperazine is sourced from PubChem (CID 64848456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).