C15H32N2O2S — CID 64849321
2,5-bis(2-methylpropyl)-1-(2-methylsulfonylethyl)piperazine (PubChem CID 64849321) has the molecular formula C15H32N2O2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 2,5-bis(2-methylpropyl)-1-(2-methylsulfonylethyl)piperazine.
| Compound Name | 2,5-bis(2-methylpropyl)-1-(2-methylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 64849321 |
| Molecular Formula | C15H32N2O2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2,5-bis(2-methylpropyl)-1-(2-methylsulfonylethyl)piperazine |
| SMILES | CC(C)CC1CN(CCS(C)(=O)=O)C(CC(C)C)CN1 |
| InChI | InChI=1S/C15H32N2O2S/c1-12(2)8-14-11-17(6-7-20(5,18)19)15(10-16-14)9-13(3)4/h12-16H,6-11H2,1-5H3 |
| InChIKey | YPTOLONFCRWRIZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |