C10H9BrF4O — CID 64855013
2-(2-bromo-3,3,3-trifluoropropoxy)-1-fluoro-4-methylbenzene (PubChem CID 64855013) has the molecular formula C10H9BrF4O and a molecular weight of 301.08 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropoxy)-1-fluoro-4-methylbenzene.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropoxy)-1-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 64855013 |
| Molecular Formula | C10H9BrF4O |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropoxy)-1-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)c(OCC(Br)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9BrF4O/c1-6-2-3-7(12)8(4-6)16-5-9(11)10(13,14)15/h2-4,9H,5H2,1H3 |
| InChIKey | ZNXXZGXFOGXTAA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|