C17H27N3 — CID 64857796
2-methyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64857796) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-methyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-methyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64857796 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 2-methyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1nc2c(n1C1C3(C)CCC(C3)C1(C)C)CCNC2 |
| InChI | InChI=1S/C17H27N3/c1-11-19-13-10-18-8-6-14(13)20(11)15-16(2,3)12-5-7-17(15,4)9-12/h12,15,18H,5-10H2,1-4H3 |
| InChIKey | XXRPBHNOFMUSLN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |