C14H23N3 — CID 79350625
2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 79350625) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79350625 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1nc2c(n1C1C(C)(C)C1(C)C)CCNC2 |
| InChI | InChI=1S/C14H23N3/c1-9-16-10-8-15-7-6-11(10)17(9)12-13(2,3)14(12,4)5/h12,15H,6-8H2,1-5H3 |
| InChIKey | CWVMAKHIBAAPCP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |