C14H15NO3 — CID 648600
3-(4,6-dimethyl-2-oxoquinolin-1-yl)propanoic acid (PubChem CID 648600) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-oxoquinolin-1-yl)propanoic acid.
| Compound Name | 3-(4,6-dimethyl-2-oxoquinolin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 648600 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-(4,6-dimethyl-2-oxoquinolin-1-yl)propanoic acid |
| SMILES | Cc1ccc2c(c1)c(C)cc(=O)n2CCC(=O)O |
| InChI | InChI=1S/C14H15NO3/c1-9-3-4-12-11(7-9)10(2)8-13(16)15(12)6-5-14(17)18/h3-4,7-8H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | IJPMOOLUWLFNOJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |