C10H20N2 — CID 64860529
5-cyclopropyl-1,2,2-trimethylpiperazine (PubChem CID 64860529) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-cyclopropyl-1,2,2-trimethylpiperazine.
| Compound Name | 5-cyclopropyl-1,2,2-trimethylpiperazine |
|---|---|
| PubChem CID | 64860529 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 5-cyclopropyl-1,2,2-trimethylpiperazine |
| SMILES | CN1CC(C2CC2)NCC1(C)C |
| InChI | InChI=1S/C10H20N2/c1-10(2)7-11-9(6-12(10)3)8-4-5-8/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | AOXLPXQQMGCCCX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |