C13H23FN2 — CID 80698037
2,5-dicyclopropyl-1-(2-fluoroethyl)-2-methylpiperazine (PubChem CID 80698037) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is 2,5-dicyclopropyl-1-(2-fluoroethyl)-2-methylpiperazine.
| Compound Name | 2,5-dicyclopropyl-1-(2-fluoroethyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 80698037 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2,5-dicyclopropyl-1-(2-fluoroethyl)-2-methylpiperazine |
| SMILES | CC1(C2CC2)CNC(C2CC2)CN1CCF |
| InChI | InChI=1S/C13H23FN2/c1-13(11-4-5-11)9-15-12(10-2-3-10)8-16(13)7-6-14/h10-12,15H,2-9H2,1H3 |
| InChIKey | WZUFNEULMQKUCD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |