C16H26N2S — CID 64861458
5-cyclopropyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)piperazine (PubChem CID 64861458) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 5-cyclopropyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)piperazine.
| Compound Name | 5-cyclopropyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)piperazine |
|---|---|
| PubChem CID | 64861458 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 5-cyclopropyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)piperazine |
| SMILES | CC(C)C1CNC(C2CC2)CN1CCc1ccsc1 |
| InChI | InChI=1S/C16H26N2S/c1-12(2)16-9-17-15(14-3-4-14)10-18(16)7-5-13-6-8-19-11-13/h6,8,11-12,14-17H,3-5,7,9-10H2,1-2H3 |
| InChIKey | WQGCALQCINPFSZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |