C12H20N2S — CID 64833156
2-propan-2-yl-1-(thiophen-3-ylmethyl)piperazine (PubChem CID 64833156) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-propan-2-yl-1-(thiophen-3-ylmethyl)piperazine.
| Compound Name | 2-propan-2-yl-1-(thiophen-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64833156 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-propan-2-yl-1-(thiophen-3-ylmethyl)piperazine |
| SMILES | CC(C)C1CNCCN1Cc1ccsc1 |
| InChI | InChI=1S/C12H20N2S/c1-10(2)12-7-13-4-5-14(12)8-11-3-6-15-9-11/h3,6,9-10,12-13H,4-5,7-8H2,1-2H3 |
| InChIKey | CZCBROJLDLFVOI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |