C11H18N2OS — CID 95165232
2-[(2R)-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 95165232) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-[(2R)-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 95165232 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[(2R)-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | OCC[C@@H]1CNCCN1Cc1ccsc1 |
| InChI | InChI=1S/C11H18N2OS/c14-5-1-11-7-12-3-4-13(11)8-10-2-6-15-9-10/h2,6,9,11-12,14H,1,3-5,7-8H2/t11-/m1/s1 |
| InChIKey | PQNDBZXWFWDRIN-LLVKDONJSA-N |
| XLogP | 0.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |