C13H16FNO3 — CID 64867881
(2-fluoro-4,5-dimethoxyphenyl)-pyrrolidin-2-ylmethanone (PubChem CID 64867881) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is (2-fluoro-4,5-dimethoxyphenyl)-pyrrolidin-2-ylmethanone.
| Compound Name | (2-fluoro-4,5-dimethoxyphenyl)-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 64867881 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2-fluoro-4,5-dimethoxyphenyl)-pyrrolidin-2-ylmethanone |
| SMILES | COc1cc(F)c(C(=O)C2CCCN2)cc1OC |
| InChI | InChI=1S/C13H16FNO3/c1-17-11-6-8(9(14)7-12(11)18-2)13(16)10-4-3-5-15-10/h6-7,10,15H,3-5H2,1-2H3 |
| InChIKey | WXMIYMLGEMXTAD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |