C17H21BrN2S — CID 64870571
1-[(4-bromothiophen-2-yl)methyl]-7-methyl-3-phenyl-1,4-diazepane (PubChem CID 64870571) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-7-methyl-3-phenyl-1,4-diazepane.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-7-methyl-3-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 64870571 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-7-methyl-3-phenyl-1,4-diazepane |
| SMILES | CC1CCNC(c2ccccc2)CN1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C17H21BrN2S/c1-13-7-8-19-17(14-5-3-2-4-6-14)11-20(13)10-16-9-15(18)12-21-16/h2-6,9,12-13,17,19H,7-8,10-11H2,1H3 |
| InChIKey | DJJDNZBRKDEWLI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |