C12H24N2 — CID 64875613
8-ethyl-6,8-dimethyl-6,9-diazaspiro[4.5]decane (PubChem CID 64875613) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 8-ethyl-6,8-dimethyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-6,8-dimethyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64875613 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 8-ethyl-6,8-dimethyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1(C)CN(C)C2(CCCC2)CN1 |
| InChI | InChI=1S/C12H24N2/c1-4-11(2)10-14(3)12(9-13-11)7-5-6-8-12/h13H,4-10H2,1-3H3 |
| InChIKey | SGTHGTBBMKDDHF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |