C14H22N2S — CID 64876781
8-methyl-9-(thiophen-3-ylmethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64876781) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 8-methyl-9-(thiophen-3-ylmethyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-methyl-9-(thiophen-3-ylmethyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64876781 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 8-methyl-9-(thiophen-3-ylmethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CC1CNC2(CCCC2)CN1Cc1ccsc1 |
| InChI | InChI=1S/C14H22N2S/c1-12-8-15-14(5-2-3-6-14)11-16(12)9-13-4-7-17-10-13/h4,7,10,12,15H,2-3,5-6,8-9,11H2,1H3 |
| InChIKey | WBIYDSUOMLTBRJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |