About 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane
16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane (PubChem CID 64877449) has the molecular formula C19H36N2
and a molecular weight of 292.51 g/mol. Its IUPAC name is 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane.
Molecular Properties
| Compound Name | 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane |
| PubChem CID | 64877449 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane |
| SMILES | CC(C)CCN1CC2(CCCCC2)NCC12CCCCC2 |
| InChI | InChI=1S/C19H36N2/c1-17(2)9-14-21-16-18(10-5-3-6-11-18)20-15-19(21)12-7-4-8-13-19/h17,20H,3-16H2,1-2H3 |
| InChIKey | MLZCBPGBRVPGPV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane?
The IUPAC name of 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane (CID 64877449) is 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane.
What is the SMILES notation for 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane?
The canonical SMILES for 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane is CC(C)CCN1CC2(CCCCC2)NCC12CCCCC2.
What is the InChIKey of 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane?
The InChIKey is MLZCBPGBRVPGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N2/c1-17(2)9-14-21-16-18(10-5-3-6-11-18)20-15-19(21)12-7-4-8-13-19/h17,20H,3-16H2,1-2H3.
What are the key properties of 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane?
16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane has a molecular weight of 292.51 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-(3-methylbutyl)-8,16-diazadispiro[5.2.59.26]hexadecane is sourced from PubChem (CID 64877449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).