C17H34N2 — CID 64878169
8,8-diethyl-9-(2-methylbutyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64878169) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 8,8-diethyl-9-(2-methylbutyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8,8-diethyl-9-(2-methylbutyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64878169 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 8,8-diethyl-9-(2-methylbutyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCC(C)CN1CC2(CCCC2)NCC1(CC)CC |
| InChI | InChI=1S/C17H34N2/c1-5-15(4)12-19-14-16(10-8-9-11-16)18-13-17(19,6-2)7-3/h15,18H,5-14H2,1-4H3 |
| InChIKey | OSVGXFCJMVYZJS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |