C18H29N3 — CID 64877786
8,8-diethyl-9-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64877786) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 8,8-diethyl-9-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8,8-diethyl-9-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64877786 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 8,8-diethyl-9-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1(CC)CNC2(CCCC2)CN1Cc1ccccn1 |
| InChI | InChI=1S/C18H29N3/c1-3-18(4-2)14-20-17(10-6-7-11-17)15-21(18)13-16-9-5-8-12-19-16/h5,8-9,12,20H,3-4,6-7,10-11,13-15H2,1-2H3 |
| InChIKey | ZSYYMVGPNMAAQM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |