C11H20N2O4S — CID 64879311
6-tert-butyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione (PubChem CID 64879311) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is 6-tert-butyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione.
| Compound Name | 6-tert-butyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64879311 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 6-tert-butyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione |
| SMILES | CC(C)(C)C1C(=O)NCC(=O)N1CCS(C)(=O)=O |
| InChI | InChI=1S/C11H20N2O4S/c1-11(2,3)9-10(15)12-7-8(14)13(9)5-6-18(4,16)17/h9H,5-7H2,1-4H3,(H,12,15) |
| InChIKey | SVBVNYPXSHKFIA-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |