C14H14Cl2N2O2 — CID 64881630
6-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione (PubChem CID 64881630) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 6-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione.
| Compound Name | 6-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64881630 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 6-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione |
| SMILES | O=C1NCC(=O)N(Cc2c(Cl)cccc2Cl)C1C1CC1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-10-2-1-3-11(16)9(10)7-18-12(19)6-17-14(20)13(18)8-4-5-8/h1-3,8,13H,4-7H2,(H,17,20) |
| InChIKey | PQDPEQQMLHUFRE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |