C11H10Cl2N2O2 — CID 64875034
1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione (PubChem CID 64875034) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64875034 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]piperazine-2,5-dione |
| SMILES | O=C1CN(Cc2c(Cl)cccc2Cl)C(=O)CN1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-8-2-1-3-9(13)7(8)5-15-6-10(16)14-4-11(15)17/h1-3H,4-6H2,(H,14,16) |
| InChIKey | LJRXZVOOFBYZQH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |