C12H13FN2O2 — CID 105375774
1-[(5-fluoro-2-methylphenyl)methyl]piperazine-2,5-dione (PubChem CID 105375774) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methylphenyl)methyl]piperazine-2,5-dione.
| Compound Name | 1-[(5-fluoro-2-methylphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 105375774 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-[(5-fluoro-2-methylphenyl)methyl]piperazine-2,5-dione |
| SMILES | Cc1ccc(F)cc1CN1CC(=O)NCC1=O |
| InChI | InChI=1S/C12H13FN2O2/c1-8-2-3-10(13)4-9(8)6-15-7-11(16)14-5-12(15)17/h2-4H,5-7H2,1H3,(H,14,16) |
| InChIKey | WYNPKOMRLALIIQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |