C10H15F3N2O2 — CID 64881850
3-propyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane-2,5-dione (PubChem CID 64881850) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-propyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-propyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64881850 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-propyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane-2,5-dione |
| SMILES | CCCC1NC(=O)CCN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C10H15F3N2O2/c1-2-3-7-9(17)15(6-10(11,12)13)5-4-8(16)14-7/h7H,2-6H2,1H3,(H,14,16) |
| InChIKey | VZNJFTFMWPLLGU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |