C9H16N2O2 — CID 64882407
7-methyl-1-propan-2-yl-1,4-diazepane-2,5-dione (PubChem CID 64882407) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 7-methyl-1-propan-2-yl-1,4-diazepane-2,5-dione.
| Compound Name | 7-methyl-1-propan-2-yl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64882407 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 7-methyl-1-propan-2-yl-1,4-diazepane-2,5-dione |
| SMILES | CC(C)N1C(=O)CNC(=O)CC1C |
| InChI | InChI=1S/C9H16N2O2/c1-6(2)11-7(3)4-8(12)10-5-9(11)13/h6-7H,4-5H2,1-3H3,(H,10,12) |
| InChIKey | BATJWIQGCIRCAS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |