C16H26N2O3 — CID 64882664
3-cyclohexyl-1-(oxolan-3-ylmethyl)-1,4-diazepane-2,5-dione (PubChem CID 64882664) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-cyclohexyl-1-(oxolan-3-ylmethyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-cyclohexyl-1-(oxolan-3-ylmethyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64882664 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3-cyclohexyl-1-(oxolan-3-ylmethyl)-1,4-diazepane-2,5-dione |
| SMILES | O=C1CCN(CC2CCOC2)C(=O)C(C2CCCCC2)N1 |
| InChI | InChI=1S/C16H26N2O3/c19-14-6-8-18(10-12-7-9-21-11-12)16(20)15(17-14)13-4-2-1-3-5-13/h12-13,15H,1-11H2,(H,17,19) |
| InChIKey | JWLKMBJFWFTXMY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |