C14H24N2O4S — CID 64881696
3-cyclohexyl-1-(2-methylsulfonylethyl)-1,4-diazepane-2,5-dione (PubChem CID 64881696) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2-methylsulfonylethyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-cyclohexyl-1-(2-methylsulfonylethyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64881696 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-cyclohexyl-1-(2-methylsulfonylethyl)-1,4-diazepane-2,5-dione |
| SMILES | CS(=O)(=O)CCN1CCC(=O)NC(C2CCCCC2)C1=O |
| InChI | InChI=1S/C14H24N2O4S/c1-21(19,20)10-9-16-8-7-12(17)15-13(14(16)18)11-5-3-2-4-6-11/h11,13H,2-10H2,1H3,(H,15,17) |
| InChIKey | PLACDXKPDUIBJI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |