C12H20N2O2S — CID 64972038
3-cyclopropyl-1-(3-methylsulfanylpropyl)-1,4-diazepane-2,5-dione (PubChem CID 64972038) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 3-cyclopropyl-1-(3-methylsulfanylpropyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-cyclopropyl-1-(3-methylsulfanylpropyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64972038 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-cyclopropyl-1-(3-methylsulfanylpropyl)-1,4-diazepane-2,5-dione |
| SMILES | CSCCCN1CCC(=O)NC(C2CC2)C1=O |
| InChI | InChI=1S/C12H20N2O2S/c1-17-8-2-6-14-7-5-10(15)13-11(12(14)16)9-3-4-9/h9,11H,2-8H2,1H3,(H,13,15) |
| InChIKey | IMODPVWVZPKDHF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|