C15H28N2O2 — CID 64883530
3-butan-2-yl-1-(2-methylpentyl)-1,4-diazepane-2,5-dione (PubChem CID 64883530) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2-methylpentyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-butan-2-yl-1-(2-methylpentyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64883530 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3-butan-2-yl-1-(2-methylpentyl)-1,4-diazepane-2,5-dione |
| SMILES | CCCC(C)CN1CCC(=O)NC(C(C)CC)C1=O |
| InChI | InChI=1S/C15H28N2O2/c1-5-7-11(3)10-17-9-8-13(18)16-14(15(17)19)12(4)6-2/h11-12,14H,5-10H2,1-4H3,(H,16,18) |
| InChIKey | HVMNNBWXONUFHK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |