C16H19N3O2 — CID 64885072
3,6-dicyclopropyl-1-(pyridin-2-ylmethyl)piperazine-2,5-dione (PubChem CID 64885072) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3,6-dicyclopropyl-1-(pyridin-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3,6-dicyclopropyl-1-(pyridin-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64885072 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3,6-dicyclopropyl-1-(pyridin-2-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1NC(C2CC2)C(=O)N(Cc2ccccn2)C1C1CC1 |
| InChI | InChI=1S/C16H19N3O2/c20-15-14(11-6-7-11)19(9-12-3-1-2-8-17-12)16(21)13(18-15)10-4-5-10/h1-3,8,10-11,13-14H,4-7,9H2,(H,18,20) |
| InChIKey | HGZPDAIJOYRERH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |