C16H24N2O3 — CID 64885637
3,6-dicyclopropyl-1-(oxan-4-ylmethyl)piperazine-2,5-dione (PubChem CID 64885637) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3,6-dicyclopropyl-1-(oxan-4-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3,6-dicyclopropyl-1-(oxan-4-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64885637 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3,6-dicyclopropyl-1-(oxan-4-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1NC(C2CC2)C(=O)N(CC2CCOCC2)C1C1CC1 |
| InChI | InChI=1S/C16H24N2O3/c19-15-14(12-3-4-12)18(9-10-5-7-21-8-6-10)16(20)13(17-15)11-1-2-11/h10-14H,1-9H2,(H,17,19) |
| InChIKey | ZGFXTIBAAAAKES-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |