C14H24N2O4 — CID 64886596
3-cyclopropyl-1-[2-(2-methoxyethoxy)ethyl]-6,6-dimethylpiperazine-2,5-dione (PubChem CID 64886596) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-cyclopropyl-1-[2-(2-methoxyethoxy)ethyl]-6,6-dimethylpiperazine-2,5-dione.
| Compound Name | 3-cyclopropyl-1-[2-(2-methoxyethoxy)ethyl]-6,6-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64886596 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-cyclopropyl-1-[2-(2-methoxyethoxy)ethyl]-6,6-dimethylpiperazine-2,5-dione |
| SMILES | COCCOCCN1C(=O)C(C2CC2)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-14(2)13(18)15-11(10-4-5-10)12(17)16(14)6-7-20-9-8-19-3/h10-11H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | XCWXCMLALGJCJF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|