About 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione
3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione (PubChem CID 64887166) has the molecular formula C14H24N2O4S
and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione |
| PubChem CID | 64887166 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione |
| SMILES | CCC1(CC)C(=O)NC(C2CC2)C(=O)N1CCS(C)(=O)=O |
| InChI | InChI=1S/C14H24N2O4S/c1-4-14(5-2)13(18)15-11(10-6-7-10)12(17)16(14)8-9-21(3,19)20/h10-11H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | WFBDIGLHBUGXKT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione?
The IUPAC name of 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione (CID 64887166) is 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione.
What is the SMILES notation for 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione?
The canonical SMILES for 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione is CCC1(CC)C(=O)NC(C2CC2)C(=O)N1CCS(C)(=O)=O.
What is the InChIKey of 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione?
The InChIKey is WFBDIGLHBUGXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O4S/c1-4-14(5-2)13(18)15-11(10-6-7-10)12(17)16(14)8-9-21(3,19)20/h10-11H,4-9H2,1-3H3,(H,15,18).
What are the key properties of 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione?
3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione has a molecular weight of 316.42 g/mol, XLogP of 0.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-6,6-diethyl-1-(2-methylsulfonylethyl)piperazine-2,5-dione is sourced from PubChem (CID 64887166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).