C14H26N2O4S — CID 64903402
3,6,6-triethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione (PubChem CID 64903402) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is 3,6,6-triethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione.
| Compound Name | 3,6,6-triethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64903402 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3,6,6-triethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)(CC)N(CCCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C14H26N2O4S/c1-5-11-12(17)16(9-8-10-21(4,19)20)14(6-2,7-3)13(18)15-11/h11H,5-10H2,1-4H3,(H,15,18) |
| InChIKey | NOAJGHHLECVSHW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |