C16H26N2O3 — CID 64887421
8-butan-2-yl-9-(oxolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64887421) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 8-butan-2-yl-9-(oxolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 8-butan-2-yl-9-(oxolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64887421 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 8-butan-2-yl-9-(oxolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CCC(C)C1C(=O)NC2(CCCC2)C(=O)N1C1CCOC1 |
| InChI | InChI=1S/C16H26N2O3/c1-3-11(2)13-14(19)17-16(7-4-5-8-16)15(20)18(13)12-6-9-21-10-12/h11-13H,3-10H2,1-2H3,(H,17,19) |
| InChIKey | DTVJVPVYWSWJSH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |