C7H7N3OS2 — CID 6489255
2-imino-3-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 6489255) has the molecular formula C7H7N3OS2 and a molecular weight of 213.29 g/mol. Its IUPAC name is 2-imino-3-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-3-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6489255 |
| Molecular Formula | C7H7N3OS2 |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 2-imino-3-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1nc(C)cs1 |
| InChI | InChI=1S/C7H7N3OS2/c1-4-2-13-7(9-4)10-5(11)3-12-6(10)8/h2,8H,3H2,1H3/b8-6- |
| InChIKey | PMMSEIYOKZZFNY-VURMDHGXSA-N |
| XLogP | 1.47 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|