C12H20N2O5 — CID 64895769
3-amino-4-[2-(2-carboxyethyl)piperidin-1-yl]-4-oxobutanoic acid (PubChem CID 64895769) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-amino-4-[2-(2-carboxyethyl)piperidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[2-(2-carboxyethyl)piperidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64895769 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-amino-4-[2-(2-carboxyethyl)piperidin-1-yl]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)N1CCCCC1CCC(=O)O |
| InChI | InChI=1S/C12H20N2O5/c13-9(7-11(17)18)12(19)14-6-2-1-3-8(14)4-5-10(15)16/h8-9H,1-7,13H2,(H,15,16)(H,17,18) |
| InChIKey | WLETTXLDACYOSU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |