C14H26N2O4 — CID 81088985
3-[1-(2-amino-5-methoxypentanoyl)piperidin-2-yl]propanoic acid (PubChem CID 81088985) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-[1-(2-amino-5-methoxypentanoyl)piperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-(2-amino-5-methoxypentanoyl)piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 81088985 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-[1-(2-amino-5-methoxypentanoyl)piperidin-2-yl]propanoic acid |
| SMILES | COCCCC(N)C(=O)N1CCCCC1CCC(=O)O |
| InChI | InChI=1S/C14H26N2O4/c1-20-10-4-6-12(15)14(19)16-9-3-2-5-11(16)7-8-13(17)18/h11-12H,2-10,15H2,1H3,(H,17,18) |
| InChIKey | WVYJXEKXRRPVRF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|