C10H20F3N3O — CID 64899600
3-amino-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-ol (PubChem CID 64899600) has the molecular formula C10H20F3N3O and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-amino-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-ol.
| Compound Name | 3-amino-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 64899600 |
| Molecular Formula | C10H20F3N3O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-amino-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-ol |
| SMILES | CC(N)C(CO)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H20F3N3O/c1-8(14)9(6-17)16-4-2-15(3-5-16)7-10(11,12)13/h8-9,17H,2-7,14H2,1H3 |
| InChIKey | CPMSKEIMQBQJLN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |