C15H17N5 — CID 64900506
4-[methyl(piperidin-3-yl)amino]cinnoline-3-carbonitrile (PubChem CID 64900506) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-[methyl(piperidin-3-yl)amino]cinnoline-3-carbonitrile.
| Compound Name | 4-[methyl(piperidin-3-yl)amino]cinnoline-3-carbonitrile |
|---|---|
| PubChem CID | 64900506 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[methyl(piperidin-3-yl)amino]cinnoline-3-carbonitrile |
| SMILES | CN(c1c(C#N)nnc2ccccc12)C1CCCNC1 |
| InChI | InChI=1S/C15H17N5/c1-20(11-5-4-8-17-10-11)15-12-6-2-3-7-13(12)18-19-14(15)9-16/h2-3,6-7,11,17H,4-5,8,10H2,1H3 |
| InChIKey | RBTPCIYGKIBYMW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |